cas: 1482-62-8 — see every product listed under this CAS number, including other names
1-(4-Chlorophenyl)-3-cyanoguanidine 95% (CAS 1482-62-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A198270-250mg |
| cas | 1482-62-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 348.12 Pln | |
| Ambeed | 1g | 464.94 Pln | |
| Ambeed | 5g | 1065.69 Pln | |
| Ambeed | 10g | 1744.31 Pln | |
| Ambeed | 25g | 3318.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A198270 |
2-(4-chlorophenyl)-1-cyanoguanidine (CAS 1482-62-8) is a chemical compound with the molecular formula C8H7ClN4 and a molecular weight of 194.62 g/mol. IUPAC name: 2-(4-chlorophenyl)-1-cyanoguanidine. InChIKey: JMEJOUCPQDFPFK-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN4 |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-1-cyanoguanidine |
| InChIKey | JMEJOUCPQDFPFK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N=C(N)NC#N)Cl |
Computed by PubChem (NCBI)