cas: 556-10-5 — see every product listed under this CAS number, including other names
1-(4-Nitrophenyl)urea 98% (CAS 556-10-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A342351-250mg |
| cas | 556-10-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 909.94 Pln | |
| Ambeed | 10g | 1538.50 Pln | |
| Ambeed | 25g | 3029.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A342351 |
(4-nitrophenyl)urea (CAS 556-10-5) is a chemical compound with the molecular formula C7H7N3O3 and a molecular weight of 181.15 g/mol. IUPAC name: (4-nitrophenyl)urea. InChIKey: LXXTVGKSGJADFU-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O3 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | (4-nitrophenyl)urea |
| InChIKey | LXXTVGKSGJADFU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)