cas: 556-10-5 — see every product listed under this CAS number, including other names
N-(4-nitrophenyl)urea (CAS 556-10-5) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F350552-200MG |
| cas | 556-10-5 |
| size | 200mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 200mg | 221.81 Pln | |
| Fluorochem | 250mg | 237.43 Pln | |
| Fluorochem | 1g | 445.69 Pln | |
| Fluorochem | 5g | 1278.73 Pln | |
| Fluorochem | 10g | 2174.25 Pln |
| delivery time | 3-4 weeks |
|---|
(4-nitrophenyl)urea (CAS 556-10-5) is a chemical compound with the molecular formula C7H7N3O3 and a molecular weight of 181.15 g/mol. IUPAC name: (4-nitrophenyl)urea. InChIKey: LXXTVGKSGJADFU-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O3 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | (4-nitrophenyl)urea |
| InChIKey | LXXTVGKSGJADFU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)