cas: 214541-35-2 — see every product listed under this CAS number, including other names
1-(4-fluorophenyl)-1H-1,2,3-triazole-4-carboxylic acid, 98% (CAS 214541-35-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F356714-100MG |
| cas | 214541-35-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 737.26 Pln | |
| Fluorochem | 250mg | 1158.98 Pln | |
| Fluorochem | 1g | 2309.62 Pln | |
| Fluorochem | 5g | 6792.42 Pln | |
| Fluorochem | 10g | 13534.84 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-(4-fluorophenyl)triazole-4-carboxylic acid (CAS 214541-35-2) is a chemical compound with the molecular formula C9H6FN3O2 and a molecular weight of 207.16 g/mol. IUPAC name: 1-(4-fluorophenyl)triazole-4-carboxylic acid. InChIKey: CCCIZOONJWEKRR-UHFFFAOYSA-N.
| Molecular formula | C9H6FN3O2 |
|---|---|
| Molecular weight | 207.16 g/mol |
| IUPAC name | 1-(4-fluorophenyl)triazole-4-carboxylic acid |
| InChIKey | CCCIZOONJWEKRR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C=C(N=N2)C(=O)O)F |
Computed by PubChem (NCBI)