Products 1552231-28-3
CAS 1552231-28-3 is the registry number for 1-(4-Fluorophenyl)-1,2,4-triazole-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(4-fluorophenyl)-1,2,4-triazole-3-carboxylic acid (CAS 1552231-28-3) is a chemical compound with the molecular formula C9H6FN3O2 and a molecular weight of 207.16 g/mol. IUPAC name: 1-(4-fluorophenyl)-1,2,4-triazole-3-carboxylic acid. InChIKey: FDMPBBOUTYAFMA-UHFFFAOYSA-N.
| Molecular formula | C9H6FN3O2 |
|---|---|
| Molecular weight | 207.16 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-1,2,4-triazole-3-carboxylic acid |
| InChIKey | FDMPBBOUTYAFMA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C=NC(=N2)C(=O)O)F |
Computed by PubChem (NCBI)