Products 1293284-50-0
CAS 1293284-50-0 appears in our catalog under these names: 4-Fluoro-2-(2h-1,2,3-triazol-2-yl)benzoic acid, 95%, 4–Fluoro–2–(2H–1，2，3–triazol–2–yl)benzoic acid, 4-Fluoro-2-(2H-1,2,3-triazol-2-yl)benzoic acid 97%, 4-Fluoro-2-(2H-1,2,3-triazol-2-yl)benzoic acid, 95%, 95%, 4-FLUORO-2-(2H-1,2,3-TRIAZOL-2-YL)BENZOIC ACID, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
4-fluoro-2-(triazol-2-yl)benzoic acid (CAS 1293284-50-0) is a chemical compound with the molecular formula C9H6FN3O2 and a molecular weight of 207.16 g/mol. IUPAC name: 4-fluoro-2-(triazol-2-yl)benzoic acid. InChIKey: FLTYWCWXBMTXJZ-UHFFFAOYSA-N.
| Molecular formula | C9H6FN3O2 |
|---|---|
| Molecular weight | 207.16 g/mol |
| IUPAC name | 4-fluoro-2-(triazol-2-yl)benzoic acid |
| InChIKey | FLTYWCWXBMTXJZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)N2N=CC=N2)C(=O)O |
Computed by PubChem (NCBI)