CAS 209736-21-0 is the registry number for 4-(4-Fluorophenyl)-5-nitro-1H-imidazole, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-(4-fluorophenyl)-5-nitro-1H-imidazole (CAS 209736-21-0) is a chemical compound with the molecular formula C9H6FN3O2 and a molecular weight of 207.16 g/mol. IUPAC name: 4-(4-fluorophenyl)-5-nitro-1H-imidazole. InChIKey: GIIYFQFCQCAPKL-UHFFFAOYSA-N.
| Molecular formula | C9H6FN3O2 |
|---|---|
| Molecular weight | 207.16 g/mol |
| IUPAC name | 4-(4-fluorophenyl)-5-nitro-1H-imidazole |
| InChIKey | GIIYFQFCQCAPKL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(NC=N2)[N+](=O)[O-])F |
Computed by PubChem (NCBI)