CAS 1186050-58-7 appears in our catalog under these names: 2-Fluoro-6-(2h-1,2,3-triazol-2-yl)benzoic acid, 95%, 2–Fluoro–6–(2H–1,2,3–triazol–2–yl)benzoic acid, Benzoic acid, 2-fluoro-6-(2H-1,2,3-triazol-2-yl)-, 95%, 95%, 2-Fluoro-6-(2H-1,2,3-triazol-2-yl)benzoic acid, 97%+(HPLC),RG. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 25g.
2-fluoro-6-(triazol-2-yl)benzoic acid (CAS 1186050-58-7) is a chemical compound with the molecular formula C9H6FN3O2 and a molecular weight of 207.16 g/mol. IUPAC name: 2-fluoro-6-(triazol-2-yl)benzoic acid. InChIKey: NTPOZDBAGMLNQA-UHFFFAOYSA-N.
| Molecular formula | C9H6FN3O2 |
|---|---|
| Molecular weight | 207.16 g/mol |
| IUPAC name | 2-fluoro-6-(triazol-2-yl)benzoic acid |
| InChIKey | NTPOZDBAGMLNQA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(=O)O)N2N=CC=N2 |
Computed by PubChem (NCBI)