cas: 69976-70-1 — see every product listed under this CAS number, including other names
1-(5-Methyl-2-nitrophenyl)ethanone 97% (CAS 69976-70-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A126446-250mg |
| cas | 69976-70-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 159.00 Pln | |
| Ambeed | 1g | 181.25 Pln | |
| Ambeed | 5g | 359.25 Pln | |
| Ambeed | 10g | 531.69 Pln | |
| Ambeed | 25g | 1210.31 Pln | |
| Ambeed | 100g | 4230.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A126446 |
1-(5-methyl-2-nitrophenyl)ethanone (CAS 69976-70-1) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: 1-(5-methyl-2-nitrophenyl)ethanone. InChIKey: QTVGOWDJTGISJG-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | 1-(5-methyl-2-nitrophenyl)ethanone |
| InChIKey | QTVGOWDJTGISJG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)[N+](=O)[O-])C(=O)C |
Computed by PubChem (NCBI)