CAS 152434-86-1 appears in our catalog under these names: Benzyl 2,4-difluorophenyl ether, 95%, 95%, Benzyl 2,4-difluorophenyl ether, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
2,4-difluoro-1-phenylmethoxybenzene (CAS 152434-86-1) is a chemical compound with the molecular formula C13H10F2O and a molecular weight of 220.21 g/mol. IUPAC name: 2,4-difluoro-1-phenylmethoxybenzene. InChIKey: SUJMBSRZMAZPOY-UHFFFAOYSA-N.
| Molecular formula | C13H10F2O |
|---|---|
| Molecular weight | 220.21 g/mol |
| IUPAC name | 2,4-difluoro-1-phenylmethoxybenzene |
| InChIKey | SUJMBSRZMAZPOY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)