CAS 153877-53-3 appears in our catalog under these names: 2,4'-Difluorobenzhydrol, >95% (HPLC), 2-Fluoro-α-(4-fluorophenyl)benzenemethanol, 95%, 95%. Offered by: TRC, Chemat. Available pack sizes: 1g, 2,5g, 25g, 100mg, 250mg.
(2-fluorophenyl)-(4-fluorophenyl)methanol (CAS 153877-53-3) is a chemical compound with the molecular formula C13H10F2O and a molecular weight of 220.21 g/mol. IUPAC name: (2-fluorophenyl)-(4-fluorophenyl)methanol. InChIKey: WBWUCGGEUJGAIH-UHFFFAOYSA-N.
| Molecular formula | C13H10F2O |
|---|---|
| Molecular weight | 220.21 g/mol |
| IUPAC name | (2-fluorophenyl)-(4-fluorophenyl)methanol |
| InChIKey | WBWUCGGEUJGAIH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C2=CC=C(C=C2)F)O)F |
Computed by PubChem (NCBI)