CAS 98586-21-1 appears in our catalog under these names: 3,3'-Difluorobenzhydrol, 98%, 3,3'-DIFLUOROBENZHYDROL, 98%, 98%, 3,3'-Difluorobenzhydrol, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 25g, 100mg, 1g, 5g, 10g.
Bis(3-fluorophenyl)methanol (CAS 98586-21-1) is a chemical compound with the molecular formula C13H10F2O and a molecular weight of 220.21 g/mol. IUPAC name: bis(3-fluorophenyl)methanol. InChIKey: JCMJXDJOHQCPOO-UHFFFAOYSA-N.
| Molecular formula | C13H10F2O |
|---|---|
| Molecular weight | 220.21 g/mol |
| IUPAC name | bis(3-fluorophenyl)methanol |
| InChIKey | JCMJXDJOHQCPOO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C(C2=CC(=CC=C2)F)O |
Computed by PubChem (NCBI)