cas: 184970-25-0 — see every product listed under this CAS number, including other names
1-(Bromomethyl)-2-fluoro-3-(trifluoromethyl)benzene 98% (CAS 184970-25-0) is a chemical reagent available from Chemat. Available pack sizes: 100g, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A344245-100g |
| cas | 184970-25-0 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 4848.19 Pln | |
| Ambeed | 1g | 186.81 Pln | |
| Ambeed | 5g | 409.31 Pln | |
| Ambeed | 25g | 1354.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A344245 |
1-(bromomethyl)-2-fluoro-3-(trifluoromethyl)benzene (CAS 184970-25-0) is a chemical compound with the molecular formula C8H5BrF4 and a molecular weight of 257.02 g/mol. IUPAC name: 1-(bromomethyl)-2-fluoro-3-(trifluoromethyl)benzene. InChIKey: QBEHXDXQUVMEQX-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF4 |
|---|---|
| Molecular weight | 257.02 g/mol |
| IUPAC name | 1-(bromomethyl)-2-fluoro-3-(trifluoromethyl)benzene |
| InChIKey | QBEHXDXQUVMEQX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C(F)(F)F)F)CBr |
Computed by PubChem (NCBI)