cas: 184970-25-0 — see every product listed under this CAS number, including other names
2-Fluoro-3-(trifluoromethyl)benzyl bromide, 98% (CAS 184970-25-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F006422-100MG |
| cas | 184970-25-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 122.89 Pln | |
| Fluorochem | 250mg | 154.13 Pln | |
| Fluorochem | 1g | 164.54 Pln | |
| Fluorochem | 5g | 388.42 Pln | |
| Fluorochem | 10g | 700.81 Pln | |
| Fluorochem | 25g | 1263.11 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-(bromomethyl)-2-fluoro-3-(trifluoromethyl)benzene (CAS 184970-25-0) is a chemical compound with the molecular formula C8H5BrF4 and a molecular weight of 257.02 g/mol. IUPAC name: 1-(bromomethyl)-2-fluoro-3-(trifluoromethyl)benzene. InChIKey: QBEHXDXQUVMEQX-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF4 |
|---|---|
| Molecular weight | 257.02 g/mol |
| IUPAC name | 1-(bromomethyl)-2-fluoro-3-(trifluoromethyl)benzene |
| InChIKey | QBEHXDXQUVMEQX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C(F)(F)F)F)CBr |
Computed by PubChem (NCBI)