cas: 13761-32-5 — see every product listed under this CAS number, including other names
1-(Dibenzo[b,d]furan-2-yl)ethanone, 95%, 95% (CAS 13761-32-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1124MQ-100mg |
| cas | 13761-32-5 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 189.20 Pln | |
| Chemat | 250mg | 275.60 Pln | |
| Chemat | 1g | 640.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-dibenzofuran-2-ylethanone (CAS 13761-32-5) is a chemical compound with the molecular formula C14H10O2 and a molecular weight of 210.23 g/mol. IUPAC name: 1-dibenzofuran-2-ylethanone. InChIKey: QZSVCHFRQANVHN-UHFFFAOYSA-N.
| Molecular formula | C14H10O2 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 1-dibenzofuran-2-ylethanone |
| InChIKey | QZSVCHFRQANVHN-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1)OC3=CC=CC=C32 |
Computed by PubChem (NCBI)