Products 92151-76-3
CAS 92151-76-3 appears in our catalog under these names: 9H-Fluorene-3-carboxylic acid, 9H-Fluorene-3-carboxylic acid, 95%, 9H-Fluorene-3-carboxylic acid, 97%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 2,5g, 250mg, 5g, 1g, 10g, 100mg.
9H-fluorene-3-carboxylic acid (CAS 92151-76-3) is a chemical compound with the molecular formula C14H10O2 and a molecular weight of 210.23 g/mol. IUPAC name: 9H-fluorene-3-carboxylic acid. InChIKey: WYRSPZVTTMUNBL-UHFFFAOYSA-N.
| Molecular formula | C14H10O2 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 9H-fluorene-3-carboxylic acid |
| InChIKey | WYRSPZVTTMUNBL-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=C2)C(=O)O)C3=CC=CC=C31 |
Computed by PubChem (NCBI)