CAS 101488-73-7 appears in our catalog under these names: 2,6-Anthracenediol, 95%, 2，6–Dihydroxyanthracene, 2,6-Dihydroxyanthracene, >95.0%(GC), 2,6-Dihydroxyanthracene 95% GC, 2,6-Dihydroxyanthracene, 97%, 97%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 1g, 200mg, 100mg, 250mg, 5g.
Anthracene-2,6-diol (CAS 101488-73-7) is a chemical compound with the molecular formula C14H10O2 and a molecular weight of 210.23 g/mol. IUPAC name: anthracene-2,6-diol. InChIKey: JBBHFHMVEOHFRE-UHFFFAOYSA-N.
| Molecular formula | C14H10O2 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | anthracene-2,6-diol |
| InChIKey | JBBHFHMVEOHFRE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=CC3=C(C=C21)C=C(C=C3)O)O |
Computed by PubChem (NCBI)