CAS 4445-34-5 is the registry number for Dibenz(c,e)oxepine-5(7H)-one, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
7H-benzo[d][2]benzoxepin-5-one (CAS 4445-34-5) is a chemical compound with the molecular formula C14H10O2 and a molecular weight of 210.23 g/mol. IUPAC name: 7H-benzo[d][2]benzoxepin-5-one. InChIKey: UYCIYTZGOBZBME-UHFFFAOYSA-N.
| Molecular formula | C14H10O2 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 7H-benzo[d][2]benzoxepin-5-one |
| InChIKey | UYCIYTZGOBZBME-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C3=CC=CC=C3C(=O)O1 |
Computed by PubChem (NCBI)