CAS 1210-05-5 appears in our catalog under these names: Biphenyl-2,2'-dicarboxaldehyde, 97%, Biphenyl-2,2'-dicarboxaldehyde, >97.0%(GC), [1,1'-Biphenyl]-2,2'-dicarbaldehyde, 97.0%, 97.0%, [1,1'-Biphenyl]-2,2'-dicarbaldehyde, ≥97%. Offered by: Combi-blocks, TCI, Chemat, Fluorochem. Available pack sizes: 100mg.
2-(2-formylphenyl)benzaldehyde (CAS 1210-05-5) is a chemical compound with the molecular formula C14H10O2 and a molecular weight of 210.23 g/mol. IUPAC name: 2-(2-formylphenyl)benzaldehyde. InChIKey: HJFGULDHUDIPDA-UHFFFAOYSA-N.
| Molecular formula | C14H10O2 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 2-(2-formylphenyl)benzaldehyde |
| InChIKey | HJFGULDHUDIPDA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=O)C2=CC=CC=C2C=O |
Computed by PubChem (NCBI)