CAS 6954-55-8 appears in our catalog under these names: 9H-Fluorene-4-carboxylic acid, 98%, Fluorene-4-carboxylic acid/ 98+%, 9H-Fluorene-4-carboxylic acid, 96%(LC-MS),RG, 96%(LC-MS),RG. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
9H-fluorene-4-carboxylic acid (CAS 6954-55-8) is a chemical compound with the molecular formula C14H10O2 and a molecular weight of 210.23 g/mol. IUPAC name: 9H-fluorene-4-carboxylic acid. InChIKey: WJNBLUOXTBTGMB-UHFFFAOYSA-N.
| Molecular formula | C14H10O2 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 9H-fluorene-4-carboxylic acid |
| InChIKey | WJNBLUOXTBTGMB-UHFFFAOYSA-N |
| SMILES | C1C2=C(C3=CC=CC=C31)C(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)