CAS 19800-47-6 appears in our catalog under these names: [1,1'-Biphenyl]-3,3'-dicarbaldehyde, 95%, [1,1'-Biphenyl]-3,3'-dicarbaldehyde 97%, [1,1'-Biphenyl]-3,3'-dicarbaldehyde, 97%, 97%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
3-(3-formylphenyl)benzaldehyde (CAS 19800-47-6) is a chemical compound with the molecular formula C14H10O2 and a molecular weight of 210.23 g/mol. IUPAC name: 3-(3-formylphenyl)benzaldehyde. InChIKey: KRCLRHSEMGXKMY-UHFFFAOYSA-N.
| Molecular formula | C14H10O2 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 3-(3-formylphenyl)benzaldehyde |
| InChIKey | KRCLRHSEMGXKMY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=CC=CC(=C2)C=O)C=O |
Computed by PubChem (NCBI)