Products 6276-03-5
CAS 6276-03-5 appears in our catalog under these names: 1-Fluorenecarboxylic acid, 95%, 1–Fluorenecarboxylic Acid, 1-Fluorenecarboxylic Acid, >98.0%(HPLC)(T), 1-FLUORENECARBOXYLIC ACID, 97%, 1-Fluorenecarboxylic Acid, 98%(LC-MS),RG, 98%(LC-MS),RG. Offered by: Combi-blocks, GLPBio, TCI, Sigma-Aldrich, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg.
9H-fluorene-1-carboxylic acid (CAS 6276-03-5) is a chemical compound with the molecular formula C14H10O2 and a molecular weight of 210.23 g/mol. IUPAC name: 9H-fluorene-1-carboxylic acid. InChIKey: HTPXFGUCAUTOEL-UHFFFAOYSA-N.
| Molecular formula | C14H10O2 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 9H-fluorene-1-carboxylic acid |
| InChIKey | HTPXFGUCAUTOEL-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C3=C1C(=CC=C3)C(=O)O |
Computed by PubChem (NCBI)