cas: 119192-09-5 — see every product listed under this CAS number, including other names
1-[(4-Nitrophenyl)methyl]-1H-1,2,4-triazole, 98%, 98% (CAS 119192-09-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111IB8-10g |
| cas | 119192-09-5 |
| size | 10g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 453.20 Pln | |
| Chemat | 1g | 165.20 Pln | |
| Chemat | 5g | 261.20 Pln | |
| Chemat | 25g | 1024.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-[(4-nitrophenyl)methyl]-1,2,4-triazole (CAS 119192-09-5) is a chemical compound with the molecular formula C9H8N4O2 and a molecular weight of 204.19 g/mol. IUPAC name: 1-[(4-nitrophenyl)methyl]-1,2,4-triazole. InChIKey: NVRYCUYVBBCXHT-UHFFFAOYSA-N.
| Molecular formula | C9H8N4O2 |
|---|---|
| Molecular weight | 204.19 g/mol |
| IUPAC name | 1-[(4-nitrophenyl)methyl]-1,2,4-triazole |
| InChIKey | NVRYCUYVBBCXHT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN2C=NC=N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)