cas: 1250157-06-2 — see every product listed under this CAS number, including other names
1-[5-chloro-2-(difluoromethoxy)phenyl]ethan-1-one, 96%, 96% (CAS 1250157-06-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch120TQC-50mg |
| cas | 1250157-06-2 |
| size | 50mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 674.00 Pln | |
| Chemat | 100mg | 966.80 Pln | |
| Chemat | 250mg | 1365.20 Pln | |
| Chemat | 500mg | 2123.60 Pln | |
| Chemat | 1g | 2690.00 Pln | |
| Chemat | 5g | 2718.80 Pln | |
| Chemat | 10g | 2742.80 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
1-[5-chloro-2-(difluoromethoxy)phenyl]ethanone (CAS 1250157-06-2) is a chemical compound with the molecular formula C9H7ClF2O2 and a molecular weight of 220.60 g/mol. IUPAC name: 1-[5-chloro-2-(difluoromethoxy)phenyl]ethanone. InChIKey: BPMUCEHKIZKHPU-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF2O2 |
|---|---|
| Molecular weight | 220.60 g/mol |
| IUPAC name | 1-[5-chloro-2-(difluoromethoxy)phenyl]ethanone |
| InChIKey | BPMUCEHKIZKHPU-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC(=C1)Cl)OC(F)F |
Computed by PubChem (NCBI)