1-[5-chloro-2-(difluoromethoxy)phenyl]ethan-1-one, 96%
cas: 1250157-06-2 — see every product listed under this CAS number, including other names
1-[5-chloro-2-(difluoromethoxy)phenyl]ethan-1-one, 96% (CAS 1250157-06-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 2.5g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F676219-50MG |
| cas | 1250157-06-2 |
| size | 50mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 268.67 Pln | |
| Fluorochem | 100mg | 341.56 Pln | |
| Fluorochem | 250mg | 476.93 Pln | |
| Fluorochem | 500mg | 690.40 Pln | |
| Fluorochem | 1g | 914.28 Pln | |
| Fluorochem | 2.5g | 1325.59 Pln | |
| Fluorochem | 5g | 1330.80 Pln | |
| Fluorochem | 10g | 1346.42 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
1-[5-chloro-2-(difluoromethoxy)phenyl]ethanone (CAS 1250157-06-2) is a chemical compound with the molecular formula C9H7ClF2O2 and a molecular weight of 220.60 g/mol. IUPAC name: 1-[5-chloro-2-(difluoromethoxy)phenyl]ethanone. InChIKey: BPMUCEHKIZKHPU-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF2O2 |
|---|---|
| Molecular weight | 220.60 g/mol |
| IUPAC name | 1-[5-chloro-2-(difluoromethoxy)phenyl]ethanone |
| InChIKey | BPMUCEHKIZKHPU-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC(=C1)Cl)OC(F)F |
Computed by PubChem (NCBI)