cas: 93361-94-5 — see every product listed under this CAS number, including other names
1-Bromo-4,5-dichloro-2-nitrobenzene, 97% (CAS 93361-94-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F212540-1G |
| cas | 93361-94-5 |
| size | 1g |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 185.37 Pln | |
| Fluorochem | 10g | 310.33 Pln | |
| Fluorochem | 25g | 497.76 Pln | |
| Fluorochem | 100g | 1664.02 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 10g | 314.75 Pln | |
| Ambeed | 25g | 492.75 Pln | |
| Ambeed | 100g | 1605.25 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
1-bromo-4,5-dichloro-2-nitrobenzene (CAS 93361-94-5) is a chemical compound with the molecular formula C6H2BrCl2NO2 and a molecular weight of 270.89 g/mol. IUPAC name: 1-bromo-4,5-dichloro-2-nitrobenzene. InChIKey: NDJFXRVGCQJCSF-UHFFFAOYSA-N.
| Molecular formula | C6H2BrCl2NO2 |
|---|---|
| Molecular weight | 270.89 g/mol |
| IUPAC name | 1-bromo-4,5-dichloro-2-nitrobenzene |
| InChIKey | NDJFXRVGCQJCSF-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)Cl)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)