CAS 1216474-94-0 appears in our catalog under these names: 5-Bromo-4,6-dichloronicotinic acid 95%, 5-Bromo-4,6-dichloronicotinic acid, 95%, 95%, 5-Bromo-4,6-dichloronicotinic acid, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
5-bromo-4,6-dichloropyridine-3-carboxylic acid (CAS 1216474-94-0) is a chemical compound with the molecular formula C6H2BrCl2NO2 and a molecular weight of 270.89 g/mol. IUPAC name: 5-bromo-4,6-dichloropyridine-3-carboxylic acid. InChIKey: ILJBBWFZVMLVOV-UHFFFAOYSA-N.
| Molecular formula | C6H2BrCl2NO2 |
|---|---|
| Molecular weight | 270.89 g/mol |
| IUPAC name | 5-bromo-4,6-dichloropyridine-3-carboxylic acid |
| InChIKey | ILJBBWFZVMLVOV-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=N1)Cl)Br)Cl)C(=O)O |
Computed by PubChem (NCBI)