CAS 80026-18-2 is the registry number for 1-Bromo-2,3-dichloro-6-nitrobenzene 95+%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
3-bromo-1,2-dichloro-4-nitrobenzene (CAS 80026-18-2) is a chemical compound with the molecular formula C6H2BrCl2NO2 and a molecular weight of 270.89 g/mol. IUPAC name: 3-bromo-1,2-dichloro-4-nitrobenzene. InChIKey: UQXHDRHVSHCNGL-UHFFFAOYSA-N.
| Molecular formula | C6H2BrCl2NO2 |
|---|---|
| Molecular weight | 270.89 g/mol |
| IUPAC name | 3-bromo-1,2-dichloro-4-nitrobenzene |
| InChIKey | UQXHDRHVSHCNGL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])Br)Cl)Cl |
Computed by PubChem (NCBI)