CAS 1185916-72-6 is the registry number for 2-Bromo-3,5-dichloronitrobenzene, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-bromo-1,5-dichloro-3-nitrobenzene (CAS 1185916-72-6) is a chemical compound with the molecular formula C6H2BrCl2NO2 and a molecular weight of 270.89 g/mol. IUPAC name: 2-bromo-1,5-dichloro-3-nitrobenzene. InChIKey: WCUFDMVRHKUDAR-UHFFFAOYSA-N.
| Molecular formula | C6H2BrCl2NO2 |
|---|---|
| Molecular weight | 270.89 g/mol |
| IUPAC name | 2-bromo-1,5-dichloro-3-nitrobenzene |
| InChIKey | WCUFDMVRHKUDAR-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])Br)Cl)Cl |
Computed by PubChem (NCBI)