CAS 170098-91-6 is the registry number for 1-Bromo-2,5-dichloro-4-nitrobenzene. Offered by: TRC. Available pack sizes: 500mg.
1-bromo-2,5-dichloro-4-nitrobenzene (CAS 170098-91-6) is a chemical compound with the molecular formula C6H2BrCl2NO2 and a molecular weight of 270.89 g/mol. IUPAC name: 1-bromo-2,5-dichloro-4-nitrobenzene. InChIKey: MYTUPPCUVLUADY-UHFFFAOYSA-N.
| Molecular formula | C6H2BrCl2NO2 |
|---|---|
| Molecular weight | 270.89 g/mol |
| IUPAC name | 1-bromo-2,5-dichloro-4-nitrobenzene |
| InChIKey | MYTUPPCUVLUADY-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)Br)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)