CAS 343781-56-6 appears in our catalog under these names: 2-Bromo-3,5-dichloroisonicotinic acid 98%, 2-Bromo-3,5-dichloroisonicotinic acid, 98%, 98%, 2-Bromo-3,5-dichloroisonicotinic acid, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g.
2-bromo-3,5-dichloropyridine-4-carboxylic acid (CAS 343781-56-6) is a chemical compound with the molecular formula C6H2BrCl2NO2 and a molecular weight of 270.89 g/mol. IUPAC name: 2-bromo-3,5-dichloropyridine-4-carboxylic acid. InChIKey: DSKHVZJZZXHWPU-UHFFFAOYSA-N.
| Molecular formula | C6H2BrCl2NO2 |
|---|---|
| Molecular weight | 270.89 g/mol |
| IUPAC name | 2-bromo-3,5-dichloropyridine-4-carboxylic acid |
| InChIKey | DSKHVZJZZXHWPU-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=N1)Br)Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)