Products 2167444-51-9
CAS 2167444-51-9 is the registry number for 4-Bromo-2,6-dichloronicotinic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g.
4-bromo-2,6-dichloropyridine-3-carboxylic acid (CAS 2167444-51-9) is a chemical compound with the molecular formula C6H2BrCl2NO2 and a molecular weight of 270.89 g/mol. IUPAC name: 4-bromo-2,6-dichloropyridine-3-carboxylic acid. InChIKey: XEKBSMVUHAGVRQ-UHFFFAOYSA-N.
| Molecular formula | C6H2BrCl2NO2 |
|---|---|
| Molecular weight | 270.89 g/mol |
| IUPAC name | 4-bromo-2,6-dichloropyridine-3-carboxylic acid |
| InChIKey | XEKBSMVUHAGVRQ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(N=C1Cl)Cl)C(=O)O)Br |
Computed by PubChem (NCBI)