Products 35754-19-9
CAS 35754-19-9 appears in our catalog under these names: 3-Bromo-4,5-dichloronitrobenzene, 95%, 95%, 3-Bromo-4,5-dichloronitrobenzene, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g.
1-bromo-2,3-dichloro-5-nitrobenzene (CAS 35754-19-9) is a chemical compound with the molecular formula C6H2BrCl2NO2 and a molecular weight of 270.89 g/mol. IUPAC name: 1-bromo-2,3-dichloro-5-nitrobenzene. InChIKey: RCABTKXOACXLOX-UHFFFAOYSA-N.
| Molecular formula | C6H2BrCl2NO2 |
|---|---|
| Molecular weight | 270.89 g/mol |
| IUPAC name | 1-bromo-2,3-dichloro-5-nitrobenzene |
| InChIKey | RCABTKXOACXLOX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)Cl)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)