cas: 1006495-69-7 — see every product listed under this CAS number, including other names
1-Butyl-3-methyl-1H-pyrazole-4-sulfonyl chloride, 97% (CAS 1006495-69-7) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A595647-5g |
| cas | 1006495-69-7 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 7523.95 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-butyl-3-methylpyrazole-4-sulfonyl chloride (CAS 1006495-69-7) is a chemical compound with the molecular formula C8H13ClN2O2S and a molecular weight of 236.72 g/mol. IUPAC name: 1-butyl-3-methylpyrazole-4-sulfonyl chloride. InChIKey: WVUBGXKRBPBSJF-UHFFFAOYSA-N.
| Molecular formula | C8H13ClN2O2S |
|---|---|
| Molecular weight | 236.72 g/mol |
| IUPAC name | 1-butyl-3-methylpyrazole-4-sulfonyl chloride |
| InChIKey | WVUBGXKRBPBSJF-UHFFFAOYSA-N |
| SMILES | CCCCN1C=C(C(=N1)C)S(=O)(=O)Cl |
Computed by PubChem (NCBI)