CAS 252562-01-9 appears in our catalog under these names: 2-Methyl-4-(methylsulphonyl)phenylhydrazine hydrochloride, 95%, (2-Methyl-4-(methylsulfonyl)phenyl)hydrazine hydrochloride, 97%, (4-Methanesulfonyl-2-methylphenyl)hydrazine hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 2,5g.
(2-methyl-4-methylsulfonylphenyl)hydrazine;hydrochloride (CAS 252562-01-9) is a chemical compound with the molecular formula C8H13ClN2O2S and a molecular weight of 236.72 g/mol. IUPAC name: (2-methyl-4-methylsulfonylphenyl)hydrazine;hydrochloride. InChIKey: ASYDJZFOWJJWGM-UHFFFAOYSA-N.
| Molecular formula | C8H13ClN2O2S |
|---|---|
| Molecular weight | 236.72 g/mol |
| IUPAC name | (2-methyl-4-methylsulfonylphenyl)hydrazine;hydrochloride |
| InChIKey | ASYDJZFOWJJWGM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)S(=O)(=O)C)NN.Cl |
Computed by PubChem (NCBI)