Products 1006495-69-7

CAS 1006495-69-7 appears in our catalog under these names: 1-Butyl-3-methyl-1h-pyrazole-4-sulfonyl chloride, 95%, 1-Butyl-3-methyl-1H-pyrazole-4-sulfonyl chloride, 97%, 1-Butyl-3-methyl-1H-pyrazole-4-sulfonyl chloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 100mg.

Structural formula: {0} (CAS {1})

1-butyl-3-methylpyrazole-4-sulfonyl chloride (CAS 1006495-69-7) is a chemical compound with the molecular formula C8H13ClN2O2S and a molecular weight of 236.72 g/mol. IUPAC name: 1-butyl-3-methylpyrazole-4-sulfonyl chloride. InChIKey: WVUBGXKRBPBSJF-UHFFFAOYSA-N.

Identity
Molecular formulaC8H13ClN2O2S
Molecular weight236.72 g/mol
IUPAC name1-butyl-3-methylpyrazole-4-sulfonyl chloride
InChIKeyWVUBGXKRBPBSJF-UHFFFAOYSA-N
SMILESCCCCN1C=C(C(=N1)C)S(=O)(=O)Cl

Computed by PubChem (NCBI)