CAS 1817776-68-3 appears in our catalog under these names: (6-(Ethylsulfonyl)pyridin-3-yl)methanamine hydrochloride, 95%, (6-(Ethylsulfonyl)pyridin-3-yl)methanamine hydrochloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
(6-ethylsulfonyl-3-pyridinyl)methanamine;hydrochloride (CAS 1817776-68-3) is a chemical compound with the molecular formula C8H13ClN2O2S and a molecular weight of 236.72 g/mol. IUPAC name: (6-ethylsulfonyl-3-pyridinyl)methanamine;hydrochloride. InChIKey: DHWDJRFTFMDDEM-UHFFFAOYSA-N.
| Molecular formula | C8H13ClN2O2S |
|---|---|
| Molecular weight | 236.72 g/mol |
| IUPAC name | (6-ethylsulfonyl-3-pyridinyl)methanamine;hydrochloride |
| InChIKey | DHWDJRFTFMDDEM-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C1=NC=C(C=C1)CN.Cl |
Computed by PubChem (NCBI)