CAS 1269152-25-1 appears in our catalog under these names: Ethyl 4-methyl-2-(methylamino)-1,3-thiazole-5-carboxylate hydrochloride, 95%, ethyl 4-methyl-2-(methylamino)-1,3-thiazole-5-carboxylate hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 2,5g.
Ethyl 4-methyl-2-(methylamino)-1,3-thiazole-5-carboxylate;hydrochloride (CAS 1269152-25-1) is a chemical compound with the molecular formula C8H13ClN2O2S and a molecular weight of 236.72 g/mol. IUPAC name: ethyl 4-methyl-2-(methylamino)-1,3-thiazole-5-carboxylate;hydrochloride. InChIKey: JTCKHJPPLZPUHI-UHFFFAOYSA-N.
| Molecular formula | C8H13ClN2O2S |
|---|---|
| Molecular weight | 236.72 g/mol |
| IUPAC name | ethyl 4-methyl-2-(methylamino)-1,3-thiazole-5-carboxylate;hydrochloride |
| InChIKey | JTCKHJPPLZPUHI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(S1)NC)C.Cl |
Computed by PubChem (NCBI)