CAS 1170256-90-2 appears in our catalog under these names: 2–(Methylsulfonylamino)benzylamine Hydrochloride, 2-(Methylsulfonylamino)benzylamine hydrochloride, 2-(Methylsulfonylamino)benzylamine hydrochloride, 95%. Offered by: GLPBio, Biosynth, Combi-blocks. Available pack sizes: 1g, 5g, 0,5g, 250mg.
N-[2-(aminomethyl)phenyl]methanesulfonamide;hydrochloride (CAS 1170256-90-2) is a chemical compound with the molecular formula C8H13ClN2O2S and a molecular weight of 236.72 g/mol. IUPAC name: N-[2-(aminomethyl)phenyl]methanesulfonamide;hydrochloride. InChIKey: NMMHZLYJVBDRMT-UHFFFAOYSA-N.
| Molecular formula | C8H13ClN2O2S |
|---|---|
| Molecular weight | 236.72 g/mol |
| IUPAC name | N-[2-(aminomethyl)phenyl]methanesulfonamide;hydrochloride |
| InChIKey | NMMHZLYJVBDRMT-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=CC=CC=C1CN.Cl |
Computed by PubChem (NCBI)