Products 1006453-74-2

CAS 1006453-74-2 appears in our catalog under these names: 1-Isobutyl-3-methyl-1h-pyrazole-4-sulfonyl chloride, 95%, 1-Isobutyl-3-methyl-1H-pyrazole-4-sulfonyl chloride, 97%, 1-Isobutyl-3-methyl-1H-pyrazole-4-sulfonyl chloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.

Structural formula: {0} (CAS {1})

3-methyl-1-(2-methylpropyl)pyrazole-4-sulfonyl chloride (CAS 1006453-74-2) is a chemical compound with the molecular formula C8H13ClN2O2S and a molecular weight of 236.72 g/mol. IUPAC name: 3-methyl-1-(2-methylpropyl)pyrazole-4-sulfonyl chloride. InChIKey: XSNOCSNKESSTGM-UHFFFAOYSA-N.

Identity
Molecular formulaC8H13ClN2O2S
Molecular weight236.72 g/mol
IUPAC name3-methyl-1-(2-methylpropyl)pyrazole-4-sulfonyl chloride
InChIKeyXSNOCSNKESSTGM-UHFFFAOYSA-N
SMILESCC1=NN(C=C1S(=O)(=O)Cl)CC(C)C

Computed by PubChem (NCBI)