CAS 1006453-74-2 appears in our catalog under these names: 1-Isobutyl-3-methyl-1h-pyrazole-4-sulfonyl chloride, 95%, 1-Isobutyl-3-methyl-1H-pyrazole-4-sulfonyl chloride, 97%, 1-Isobutyl-3-methyl-1H-pyrazole-4-sulfonyl chloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
3-methyl-1-(2-methylpropyl)pyrazole-4-sulfonyl chloride (CAS 1006453-74-2) is a chemical compound with the molecular formula C8H13ClN2O2S and a molecular weight of 236.72 g/mol. IUPAC name: 3-methyl-1-(2-methylpropyl)pyrazole-4-sulfonyl chloride. InChIKey: XSNOCSNKESSTGM-UHFFFAOYSA-N.
| Molecular formula | C8H13ClN2O2S |
|---|---|
| Molecular weight | 236.72 g/mol |
| IUPAC name | 3-methyl-1-(2-methylpropyl)pyrazole-4-sulfonyl chloride |
| InChIKey | XSNOCSNKESSTGM-UHFFFAOYSA-N |
| SMILES | CC1=NN(C=C1S(=O)(=O)Cl)CC(C)C |
Computed by PubChem (NCBI)