CAS 271597-65-0 is the registry number for Ethyl (S)-2-(1-aminoethyl)thiazole-4-carboxylate hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-[(1S)-1-aminoethyl]-1,3-thiazole-4-carboxylate;hydrochloride (CAS 271597-65-0) is a chemical compound with the molecular formula C8H13ClN2O2S and a molecular weight of 236.72 g/mol. IUPAC name: ethyl 2-[(1S)-1-aminoethyl]-1,3-thiazole-4-carboxylate;hydrochloride. InChIKey: VZZNZMSCUUMXES-JEDNCBNOSA-N.
| Molecular formula | C8H13ClN2O2S |
|---|---|
| Molecular weight | 236.72 g/mol |
| IUPAC name | ethyl 2-[(1S)-1-aminoethyl]-1,3-thiazole-4-carboxylate;hydrochloride |
| InChIKey | VZZNZMSCUUMXES-JEDNCBNOSA-N |
| SMILES | CCOC(=O)C1=CSC(=N1)[C@H](C)N.Cl |
Computed by PubChem (NCBI)