CAS 6903-62-4 is the registry number for 3,3'-Oxybis(chlorobenzene), 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
1-chloro-3-(3-chlorophenoxy)benzene (CAS 6903-62-4) is a chemical compound with the molecular formula C12H8Cl2O and a molecular weight of 239.09 g/mol. IUPAC name: 1-chloro-3-(3-chlorophenoxy)benzene. InChIKey: RQMZSXZFMWCEET-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2O |
|---|---|
| Molecular weight | 239.09 g/mol |
| IUPAC name | 1-chloro-3-(3-chlorophenoxy)benzene |
| InChIKey | RQMZSXZFMWCEET-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)OC2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)