CAS 51892-26-3 is the registry number for 2,4-Dichlorophenyl phenyl ether, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
2,4-dichloro-1-phenoxybenzene (CAS 51892-26-3) is a chemical compound with the molecular formula C12H8Cl2O and a molecular weight of 239.09 g/mol. IUPAC name: 2,4-dichloro-1-phenoxybenzene. InChIKey: KXIPYLZZJZMMPD-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2O |
|---|---|
| Molecular weight | 239.09 g/mol |
| IUPAC name | 2,4-dichloro-1-phenoxybenzene |
| InChIKey | KXIPYLZZJZMMPD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)