Products 51892-26-3

CAS 51892-26-3 is the registry number for 2,4-Dichlorophenyl phenyl ether, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

2,4-dichloro-1-phenoxybenzene (CAS 51892-26-3) is a chemical compound with the molecular formula C12H8Cl2O and a molecular weight of 239.09 g/mol. IUPAC name: 2,4-dichloro-1-phenoxybenzene. InChIKey: KXIPYLZZJZMMPD-UHFFFAOYSA-N.

Identity
Molecular formulaC12H8Cl2O
Molecular weight239.09 g/mol
IUPAC name2,4-dichloro-1-phenoxybenzene
InChIKeyKXIPYLZZJZMMPD-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)OC2=C(C=C(C=C2)Cl)Cl

Computed by PubChem (NCBI)