CAS 55538-69-7 is the registry number for 1,2–dichloro–4–phenoxy–benzene. Offered by: GLPBio. Available pack sizes: 200mg.
1,2-dichloro-4-phenoxybenzene (CAS 55538-69-7) is a chemical compound with the molecular formula C12H8Cl2O and a molecular weight of 239.09 g/mol. IUPAC name: 1,2-dichloro-4-phenoxybenzene. InChIKey: QFQLZVAAQOJUFS-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2O |
|---|---|
| Molecular weight | 239.09 g/mol |
| IUPAC name | 1,2-dichloro-4-phenoxybenzene |
| InChIKey | QFQLZVAAQOJUFS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)