cas: 906352-57-6 — see every product listed under this CAS number, including other names
1-Methyl-1H-benzimidazole-5-carbonyl chloride hydrochloride, 90% (CAS 906352-57-6) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | CC13652CB |
| cas | 906352-57-6 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 243.85 Pln | |
| Thermo Scientific | 1g | 590.53 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 90% |
1-methylbenzimidazole-5-carbonyl chloride;hydrochloride (CAS 906352-57-6) is a chemical compound with the molecular formula C9H8Cl2N2O and a molecular weight of 231.08 g/mol. IUPAC name: 1-methylbenzimidazole-5-carbonyl chloride;hydrochloride. InChIKey: SGNORNZSRSQMEE-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2N2O |
|---|---|
| Molecular weight | 231.08 g/mol |
| IUPAC name | 1-methylbenzimidazole-5-carbonyl chloride;hydrochloride |
| InChIKey | SGNORNZSRSQMEE-UHFFFAOYSA-N |
| SMILES | CN1C=NC2=C1C=CC(=C2)C(=O)Cl.Cl |
Computed by PubChem (NCBI)