CAS 2168728-37-6 is the registry number for 2-Iodo-4-(trifluoromethoxy)benzaldehyde, ≥99.4%, ≥99.4%. Offered by: Chemat. Available pack sizes: 1g.
2-iodo-4-(trifluoromethoxy)benzaldehyde (CAS 2168728-37-6) is a chemical compound with the molecular formula C8H4F3IO2 and a molecular weight of 316.02 g/mol. IUPAC name: 2-iodo-4-(trifluoromethoxy)benzaldehyde. InChIKey: RMEYPESVUGZTII-UHFFFAOYSA-N.
| Molecular formula | C8H4F3IO2 |
|---|---|
| Molecular weight | 316.02 g/mol |
| IUPAC name | 2-iodo-4-(trifluoromethoxy)benzaldehyde |
| InChIKey | RMEYPESVUGZTII-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)I)C=O |
Computed by PubChem (NCBI)