CAS 954815-11-3 appears in our catalog under these names: 4–Iodo–2–(trifluoromethyl)benzoic acid, 4-Iodo-2-(trifluoromethyl)benzoic acid 95%, 4-Iodo-2-(trifluoromethyl)benzoic acid, 95%, 95%, 4-Iodo-2-(trifluoromethyl)benzoic acid, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 250mg.
4-iodo-2-(trifluoromethyl)benzoic acid (CAS 954815-11-3) is a chemical compound with the molecular formula C8H4F3IO2 and a molecular weight of 316.02 g/mol. IUPAC name: 4-iodo-2-(trifluoromethyl)benzoic acid. InChIKey: XSQLEPZNGCNYKF-UHFFFAOYSA-N.
| Molecular formula | C8H4F3IO2 |
|---|---|
| Molecular weight | 316.02 g/mol |
| IUPAC name | 4-iodo-2-(trifluoromethyl)benzoic acid |
| InChIKey | XSQLEPZNGCNYKF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1I)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)