Products 28186-62-1
CAS 28186-62-1 appears in our catalog under these names: 3-iodo-5-(trifluoromethyl)benzoic acid, 3-Iodo-5-(trifluoromethyl)benzoic acid 95%, 3-Iodo-5-(trifluoromethyl)benzoic acid, 95%, 95%, 3-IODO-5-(TRIFLUOROMETHYL)BENZOIC ACID, 98%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 250mg, 1g, 5g, 25g.
3-iodo-5-(trifluoromethyl)benzoic acid (CAS 28186-62-1) is a chemical compound with the molecular formula C8H4F3IO2 and a molecular weight of 316.02 g/mol. IUPAC name: 3-iodo-5-(trifluoromethyl)benzoic acid. InChIKey: WKBZOFRUGGDTEU-UHFFFAOYSA-N.
| Molecular formula | C8H4F3IO2 |
|---|---|
| Molecular weight | 316.02 g/mol |
| IUPAC name | 3-iodo-5-(trifluoromethyl)benzoic acid |
| InChIKey | WKBZOFRUGGDTEU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)I)C(=O)O |
Computed by PubChem (NCBI)