CAS 188725-98-6 is the registry number for 3-Iodo-4-(trifluoromethoxy)benzaldehyde, 95+%. Offered by: AmBeed. Available pack sizes: 25g.
3-iodo-4-(trifluoromethoxy)benzaldehyde (CAS 188725-98-6) is a chemical compound with the molecular formula C8H4F3IO2 and a molecular weight of 316.02 g/mol. IUPAC name: 3-iodo-4-(trifluoromethoxy)benzaldehyde. InChIKey: NCJWPSOBHRFXEU-UHFFFAOYSA-N.
| Molecular formula | C8H4F3IO2 |
|---|---|
| Molecular weight | 316.02 g/mol |
| IUPAC name | 3-iodo-4-(trifluoromethoxy)benzaldehyde |
| InChIKey | NCJWPSOBHRFXEU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C=O)I)OC(F)(F)F |
Computed by PubChem (NCBI)