Products 766473-89-6
CAS 766473-89-6 appears in our catalog under these names: 2-Iodo-3-(trifluoromethyl)benzoic acid, 95%, 2-Iodo-3-(trifluoromethyl)benzoic acid 96%, 2-Iodo-3-(trifluoromethyl)benzoic acid, 96%, 96%, 2-Iodo-3-(trifluoromethyl)benzoic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 10g, 1g, 5g, 25g.
2-iodo-3-(trifluoromethyl)benzoic acid (CAS 766473-89-6) is a chemical compound with the molecular formula C8H4F3IO2 and a molecular weight of 316.02 g/mol. IUPAC name: 2-iodo-3-(trifluoromethyl)benzoic acid. InChIKey: DNGSEJLGVHIEEZ-UHFFFAOYSA-N.
| Molecular formula | C8H4F3IO2 |
|---|---|
| Molecular weight | 316.02 g/mol |
| IUPAC name | 2-iodo-3-(trifluoromethyl)benzoic acid |
| InChIKey | DNGSEJLGVHIEEZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C(F)(F)F)I)C(=O)O |
Computed by PubChem (NCBI)